C12H15BrO3S — CID 105410237
(3-bromo-4-methylphenyl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 105410237) has the molecular formula C12H15BrO3S and a molecular weight of 319.22 g/mol. Its IUPAC name is (3-bromo-4-methylphenyl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (3-bromo-4-methylphenyl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 105410237 |
| Molecular Formula | C12H15BrO3S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | (3-bromo-4-methylphenyl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | Cc1ccc(C(O)C2CCS(=O)(=O)C2)cc1Br |
| InChI | InChI=1S/C12H15BrO3S/c1-8-2-3-9(6-11(8)13)12(14)10-4-5-17(15,16)7-10/h2-3,6,10,12,14H,4-5,7H2,1H3 |
| InChIKey | AEPAORNFUQWWQI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |