C12H14BrClO2S — CID 106818211
3-[bromo-(3-chloro-4-methylphenyl)methyl]thiolane 1,1-dioxide (PubChem CID 106818211) has the molecular formula C12H14BrClO2S and a molecular weight of 337.67 g/mol. Its IUPAC name is 3-[bromo-(3-chloro-4-methylphenyl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[bromo-(3-chloro-4-methylphenyl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 106818211 |
| Molecular Formula | C12H14BrClO2S |
| Molecular Weight | 337.67 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 3-[bromo-(3-chloro-4-methylphenyl)methyl]thiolane 1,1-dioxide |
| SMILES | Cc1ccc(C(Br)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C12H14BrClO2S/c1-8-2-3-9(6-11(8)14)12(13)10-4-5-17(15,16)7-10/h2-3,6,10,12H,4-5,7H2,1H3 |
| InChIKey | XIFVRZYLRIMDAW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|