C14H19BrO2S — CID 64903969
3-[1-bromo-2-(3,4-dimethylphenyl)ethyl]thiolane 1,1-dioxide (PubChem CID 64903969) has the molecular formula C14H19BrO2S and a molecular weight of 331.28 g/mol. Its IUPAC name is 3-[1-bromo-2-(3,4-dimethylphenyl)ethyl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(3,4-dimethylphenyl)ethyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64903969 |
| Molecular Formula | C14H19BrO2S |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-[1-bromo-2-(3,4-dimethylphenyl)ethyl]thiolane 1,1-dioxide |
| SMILES | Cc1ccc(CC(Br)C2CCS(=O)(=O)C2)cc1C |
| InChI | InChI=1S/C14H19BrO2S/c1-10-3-4-12(7-11(10)2)8-14(15)13-5-6-18(16,17)9-13/h3-4,7,13-14H,5-6,8-9H2,1-2H3 |
| InChIKey | BFSNCTPOCFRYFO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|