C13H15BrCl2O2S — CID 66048206
3-[1-bromo-3-(3,4-dichlorophenyl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 66048206) has the molecular formula C13H15BrCl2O2S and a molecular weight of 386.14 g/mol. Its IUPAC name is 3-[1-bromo-3-(3,4-dichlorophenyl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-3-(3,4-dichlorophenyl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66048206 |
| Molecular Formula | C13H15BrCl2O2S |
| Molecular Weight | 386.14 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 3-[1-bromo-3-(3,4-dichlorophenyl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H15BrCl2O2S/c14-7-11(10-3-4-19(17,18)8-10)5-9-1-2-12(15)13(16)6-9/h1-2,6,10-11H,3-5,7-8H2 |
| InChIKey | KEQYIKDEQYCZPA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.14 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|