C14H19BrO4S — CID 66023421
3-(3-bromo-4-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol (PubChem CID 66023421) has the molecular formula C14H19BrO4S and a molecular weight of 363.27 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 66023421 |
| Molecular Formula | C14H19BrO4S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
| SMILES | COc1ccc(CC(CO)C2CCS(=O)(=O)C2)cc1Br |
| InChI | InChI=1S/C14H19BrO4S/c1-19-14-3-2-10(7-13(14)15)6-12(8-16)11-4-5-20(17,18)9-11/h2-3,7,11-12,16H,4-6,8-9H2,1H3 |
| InChIKey | SVZUQLCHOOUSBS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |