C17H26O3S — CID 66023856
3-(4-tert-butylphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol (PubChem CID 66023856) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol.
| Compound Name | 3-(4-tert-butylphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 66023856 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
| SMILES | CC(C)(C)c1ccc(CC(CO)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H26O3S/c1-17(2,3)16-6-4-13(5-7-16)10-15(11-18)14-8-9-21(19,20)12-14/h4-7,14-15,18H,8-12H2,1-3H3 |
| InChIKey | SOBGNDGPFWVBRV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |