C15H22O3S — CID 66023416
3-(3,5-dimethylphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol (PubChem CID 66023416) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol.
| Compound Name | 3-(3,5-dimethylphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 66023416 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
| SMILES | Cc1cc(C)cc(CC(CO)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H22O3S/c1-11-5-12(2)7-13(6-11)8-15(9-16)14-3-4-19(17,18)10-14/h5-7,14-16H,3-4,8-10H2,1-2H3 |
| InChIKey | RINOBWXUSURFCA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |