C13H26O3S — CID 114210553
2-(1,1-dioxothiolan-3-yl)-6,6-dimethylheptan-1-ol (PubChem CID 114210553) has the molecular formula C13H26O3S and a molecular weight of 262.41 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-6,6-dimethylheptan-1-ol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-6,6-dimethylheptan-1-ol |
|---|---|
| PubChem CID | 114210553 |
| Molecular Formula | C13H26O3S |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-6,6-dimethylheptan-1-ol |
| SMILES | CC(C)(C)CCCC(CO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26O3S/c1-13(2,3)7-4-5-11(9-14)12-6-8-17(15,16)10-12/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | LSZNYJWKZIQWJU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |