C12H23ClO3S — CID 112592385
3-[1-chloro-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]thiolane 1,1-dioxide (PubChem CID 112592385) has the molecular formula C12H23ClO3S and a molecular weight of 282.83 g/mol. Its IUPAC name is 3-[1-chloro-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 112592385 |
| Molecular Formula | C12H23ClO3S |
| Molecular Weight | 282.83 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[1-chloro-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]thiolane 1,1-dioxide |
| SMILES | CC(C)(C)OCCC(CCl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H23ClO3S/c1-12(2,3)16-6-4-10(8-13)11-5-7-17(14,15)9-11/h10-11H,4-9H2,1-3H3 |
| InChIKey | DCRALDBHZHJVIF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|