C9H14ClF3O2S2 — CID 116627920
3-[1-chloro-4-(trifluoromethylsulfanyl)butan-2-yl]thiolane 1,1-dioxide (PubChem CID 116627920) has the molecular formula C9H14ClF3O2S2 and a molecular weight of 310.79 g/mol. Its IUPAC name is 3-[1-chloro-4-(trifluoromethylsulfanyl)butan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-4-(trifluoromethylsulfanyl)butan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 116627920 |
| Molecular Formula | C9H14ClF3O2S2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 3-[1-chloro-4-(trifluoromethylsulfanyl)butan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CCl)CCSC(F)(F)F)C1 |
| InChI | InChI=1S/C9H14ClF3O2S2/c10-5-7(1-3-16-9(11,12)13)8-2-4-17(14,15)6-8/h7-8H,1-6H2 |
| InChIKey | JHCIIUQYBPQPSI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|