C11H16ClNO2S2 — CID 66035081
3-[1-chloro-3-(2-methyl-1,3-thiazol-5-yl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 66035081) has the molecular formula C11H16ClNO2S2 and a molecular weight of 293.84 g/mol. Its IUPAC name is 3-[1-chloro-3-(2-methyl-1,3-thiazol-5-yl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-3-(2-methyl-1,3-thiazol-5-yl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66035081 |
| Molecular Formula | C11H16ClNO2S2 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-[1-chloro-3-(2-methyl-1,3-thiazol-5-yl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | Cc1ncc(CC(CCl)C2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C11H16ClNO2S2/c1-8-13-6-11(16-8)4-10(5-12)9-2-3-17(14,15)7-9/h6,9-10H,2-5,7H2,1H3 |
| InChIKey | FFPJGCYHTSDVIU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|