C11H18ClNS — CID 83139081
5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole (PubChem CID 83139081) has the molecular formula C11H18ClNS and a molecular weight of 231.79 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 83139081 |
| Molecular Formula | C11H18ClNS |
| Molecular Weight | 231.79 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(CC(CCl)C(C)(C)C)s1 |
| InChI | InChI=1S/C11H18ClNS/c1-8-13-7-10(14-8)5-9(6-12)11(2,3)4/h7,9H,5-6H2,1-4H3 |
| InChIKey | NZKSWSPDDLSKQY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|