About 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole
5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole (PubChem CID 83139081) has the molecular formula C11H18ClNS
and a molecular weight of 231.79 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole |
| PubChem CID | 83139081 |
| Molecular Formula | C11H18ClNS |
| Molecular Weight | 231.79 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(CC(CCl)C(C)(C)C)s1 |
| InChI | InChI=1S/C11H18ClNS/c1-8-13-7-10(14-8)5-9(6-12)11(2,3)4/h7,9H,5-6H2,1-4H3 |
| InChIKey | NZKSWSPDDLSKQY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole?
The IUPAC name of 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole (CID 83139081) is 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole.
What is the SMILES notation for 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole?
The canonical SMILES for 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole is Cc1ncc(CC(CCl)C(C)(C)C)s1.
What is the InChIKey of 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole?
The InChIKey is NZKSWSPDDLSKQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClNS/c1-8-13-7-10(14-8)5-9(6-12)11(2,3)4/h7,9H,5-6H2,1-4H3.
What are the key properties of 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole?
5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole has a molecular weight of 231.79 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(chloromethyl)-3,3-dimethylbutyl]-2-methyl-1,3-thiazole is sourced from PubChem (CID 83139081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).