About 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol
2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol (PubChem CID 79449809) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol.
Analyze 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol?
The IUPAC name of 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol (CID 79449809) is 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol.
What is the SMILES notation for 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol?
The canonical SMILES for 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol is Cc1ncc(CC(CO)CO)s1.
What is the InChIKey of 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol?
The InChIKey is YMCCPCXFYUNTSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-6-9-3-8(12-6)2-7(4-10)5-11/h3,7,10-11H,2,4-5H2,1H3.
What are the key properties of 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol?
2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol has a molecular weight of 187.26 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diol is sourced from PubChem (CID 79449809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).