C5H6BrNS — CID 55250786
5-(bromomethyl)-2-methyl-1,3-thiazole (PubChem CID 55250786) has the molecular formula C5H6BrNS and a molecular weight of 192.08 g/mol. Its IUPAC name is 5-(bromomethyl)-2-methyl-1,3-thiazole.
| Compound Name | 5-(bromomethyl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 55250786 |
| Molecular Formula | C5H6BrNS |
| Molecular Weight | 192.08 g/mol |
| Exact Mass | 190.94 |
| IUPAC Name | 5-(bromomethyl)-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(CBr)s1 |
| InChI | InChI=1S/C5H6BrNS/c1-4-7-3-5(2-6)8-4/h3H,2H2,1H3 |
| InChIKey | WKOAATBPJLXWLP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.08 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|