C7H13NS — CID 123921924
2,5-dimethyl-1,3-thiazole;ethane (PubChem CID 123921924) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-thiazole;ethane.
| Compound Name | 2,5-dimethyl-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 123921924 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 2,5-dimethyl-1,3-thiazole;ethane |
| SMILES | CC.Cc1cnc(C)s1 |
| InChI | InChI=1S/C5H7NS.C2H6/c1-4-3-6-5(2)7-4;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | RKYRJJORWUUEIH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |