About 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane
2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane (PubChem CID 166457843) has the molecular formula C17H33NS
and a molecular weight of 283.52 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane.
Molecular Properties
| Compound Name | 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane |
| PubChem CID | 166457843 |
| Molecular Formula | C17H33NS |
| Molecular Weight | 283.52 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane |
| SMILES | CC.CC.CC1CC2(CCC2)C1.Cc1cnc(C)s1 |
| InChI | InChI=1S/C8H14.C5H7NS.2C2H6/c1-7-5-8(6-7)3-2-4-8;1-4-3-6-5(2)7-4;2*1-2/h7H,2-6H2,1H3;3H,1-2H3;2*1-2H3 |
| InChIKey | FLWKSADIAVQCQX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane?
The IUPAC name of 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane (CID 166457843) is 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane.
What is the SMILES notation for 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane?
The canonical SMILES for 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane is CC.CC.CC1CC2(CCC2)C1.Cc1cnc(C)s1.
What is the InChIKey of 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane?
The InChIKey is FLWKSADIAVQCQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.C5H7NS.2C2H6/c1-7-5-8(6-7)3-2-4-8;1-4-3-6-5(2)7-4;2*1-2/h7H,2-6H2,1H3;3H,1-2H3;2*1-2H3.
What are the key properties of 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane?
2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane has a molecular weight of 283.52 g/mol, XLogP of 6.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,3-thiazole;ethane;2-methylspiro[3.3]heptane is sourced from PubChem (CID 166457843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).