C10H15N3S — CID 91557964
1,2-dimethylimidazole;2,5-dimethyl-1,3-thiazole (PubChem CID 91557964) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 1,2-dimethylimidazole;2,5-dimethyl-1,3-thiazole.
| Compound Name | 1,2-dimethylimidazole;2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 91557964 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1,2-dimethylimidazole;2,5-dimethyl-1,3-thiazole |
| SMILES | Cc1cnc(C)s1.Cc1nccn1C |
| InChI | InChI=1S/C5H8N2.C5H7NS/c1-5-6-3-4-7(5)2;1-4-3-6-5(2)7-4/h3-4H,1-2H3;3H,1-2H3 |
| InChIKey | QKKCIQRMYBCRMN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |