C5H8BF3N2 — CID 171040969
1,2-dimethylimidazole;trifluoroborane (PubChem CID 171040969) has the molecular formula C5H8BF3N2 and a molecular weight of 163.94 g/mol. Its IUPAC name is 1,2-dimethylimidazole;trifluoroborane.
| Compound Name | 1,2-dimethylimidazole;trifluoroborane |
|---|---|
| PubChem CID | 171040969 |
| Molecular Formula | C5H8BF3N2 |
| Molecular Weight | 163.94 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 1,2-dimethylimidazole;trifluoroborane |
| SMILES | Cc1nccn1C.FB(F)F |
| InChI | InChI=1S/C5H8N2.BF3/c1-5-6-3-4-7(5)2;2-1(3)4/h3-4H,1-2H3; |
| InChIKey | HUNVUFFQUSISSQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.94 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|