About 1,2-dimethylimidazole;trifluoroborane
1,2-dimethylimidazole;trifluoroborane (PubChem CID 171040969) has the molecular formula C5H8BF3N2
and a molecular weight of 163.94 g/mol. Its IUPAC name is 1,2-dimethylimidazole;trifluoroborane.
Molecular Properties
| Compound Name | 1,2-dimethylimidazole;trifluoroborane |
| PubChem CID | 171040969 |
| Molecular Formula | C5H8BF3N2 |
| Molecular Weight | 163.94 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 1,2-dimethylimidazole;trifluoroborane |
| SMILES | Cc1nccn1C.FB(F)F |
| InChI | InChI=1S/C5H8N2.BF3/c1-5-6-3-4-7(5)2;2-1(3)4/h3-4H,1-2H3; |
| InChIKey | HUNVUFFQUSISSQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.94 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylimidazole;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylimidazole;trifluoroborane?
The IUPAC name of 1,2-dimethylimidazole;trifluoroborane (CID 171040969) is 1,2-dimethylimidazole;trifluoroborane.
What is the SMILES notation for 1,2-dimethylimidazole;trifluoroborane?
The canonical SMILES for 1,2-dimethylimidazole;trifluoroborane is Cc1nccn1C.FB(F)F.
What is the InChIKey of 1,2-dimethylimidazole;trifluoroborane?
The InChIKey is HUNVUFFQUSISSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.BF3/c1-5-6-3-4-7(5)2;2-1(3)4/h3-4H,1-2H3;.
What are the key properties of 1,2-dimethylimidazole;trifluoroborane?
1,2-dimethylimidazole;trifluoroborane has a molecular weight of 163.94 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylimidazole;trifluoroborane is sourced from PubChem (CID 171040969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).