C8H13ClN4O3S — CID 175045185
1,2-dimethylimidazole;1H-imidazole;sulfurochloridic acid (PubChem CID 175045185) has the molecular formula C8H13ClN4O3S and a molecular weight of 280.74 g/mol. Its IUPAC name is 1,2-dimethylimidazole;1H-imidazole;sulfurochloridic acid.
| Compound Name | 1,2-dimethylimidazole;1H-imidazole;sulfurochloridic acid |
|---|---|
| PubChem CID | 175045185 |
| Molecular Formula | C8H13ClN4O3S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1,2-dimethylimidazole;1H-imidazole;sulfurochloridic acid |
| SMILES | Cc1nccn1C.O=S(=O)(O)Cl.c1c[nH]cn1 |
| InChI | InChI=1S/C5H8N2.C3H4N2.ClHO3S/c1-5-6-3-4-7(5)2;1-2-5-3-4-1;1-5(2,3)4/h3-4H,1-2H3;1-3H,(H,4,5);(H,2,3,4) |
| InChIKey | KELAHXDBXGLYQF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|