C6H12N4O — CID 174990589
1,2-dimethylimidazole;urea (PubChem CID 174990589) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is 1,2-dimethylimidazole;urea.
| Compound Name | 1,2-dimethylimidazole;urea |
|---|---|
| PubChem CID | 174990589 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 1,2-dimethylimidazole;urea |
| SMILES | Cc1nccn1C.NC(N)=O |
| InChI | InChI=1S/C5H8N2.CH4N2O/c1-5-6-3-4-7(5)2;2-1(3)4/h3-4H,1-2H3;(H4,2,3,4) |
| InChIKey | ZPEORNOWCHPEMO-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |