C11H16N3O+ — CID 143854706
1,2-dimethylimidazole;1-hydroxy-4-methylpyridin-1-ium (PubChem CID 143854706) has the molecular formula C11H16N3O+ and a molecular weight of 206.27 g/mol. Its IUPAC name is 1,2-dimethylimidazole;1-hydroxy-4-methylpyridin-1-ium.
| Compound Name | 1,2-dimethylimidazole;1-hydroxy-4-methylpyridin-1-ium |
|---|---|
| PubChem CID | 143854706 |
| Molecular Formula | C11H16N3O+ |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1,2-dimethylimidazole;1-hydroxy-4-methylpyridin-1-ium |
| SMILES | Cc1cc[n+](O)cc1.Cc1nccn1C |
| InChI | InChI=1S/C6H8NO.C5H8N2/c1-6-2-4-7(8)5-3-6;1-5-6-3-4-7(5)2/h2-5,8H,1H3;3-4H,1-2H3/q+1; |
| InChIKey | HNPFXSZVTMKSIC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|