C6H8N4O2 — CID 130723706
(4-methyl-3-oxopyrazin-2-yl)urea (PubChem CID 130723706) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is (4-methyl-3-oxopyrazin-2-yl)urea.
| Compound Name | (4-methyl-3-oxopyrazin-2-yl)urea |
|---|---|
| PubChem CID | 130723706 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (4-methyl-3-oxopyrazin-2-yl)urea |
| SMILES | Cn1ccnc(NC(N)=O)c1=O |
| InChI | InChI=1S/C6H8N4O2/c1-10-3-2-8-4(5(10)11)9-6(7)12/h2-3H,1H3,(H3,7,8,9,12) |
| InChIKey | JZALJVLVKSAJJX-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |