C15H18N4O3 — CID 97261191
1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3-(4-methyl-3-oxopyrazin-2-yl)urea (PubChem CID 97261191) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3-(4-methyl-3-oxopyrazin-2-yl)urea.
| Compound Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3-(4-methyl-3-oxopyrazin-2-yl)urea |
|---|---|
| PubChem CID | 97261191 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3-(4-methyl-3-oxopyrazin-2-yl)urea |
| SMILES | Cn1ccnc(NC(=O)N[C@@H](CO)Cc2ccccc2)c1=O |
| InChI | InChI=1S/C15H18N4O3/c1-19-8-7-16-13(14(19)21)18-15(22)17-12(10-20)9-11-5-3-2-4-6-11/h2-8,12,20H,9-10H2,1H3,(H2,16,17,18,22)/t12-/m1/s1 |
| InChIKey | LWGVKFFBVZTBBO-GFCCVEGCSA-N |
| XLogP | 0.51 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |