C16H22N4O2 — CID 99702012
1-(3-ethyl-1-methylpyrazol-5-yl)-3-[(2S)-1-hydroxy-3-phenylpropan-2-yl]urea (PubChem CID 99702012) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(3-ethyl-1-methylpyrazol-5-yl)-3-[(2S)-1-hydroxy-3-phenylpropan-2-yl]urea.
| Compound Name | 1-(3-ethyl-1-methylpyrazol-5-yl)-3-[(2S)-1-hydroxy-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 99702012 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-(3-ethyl-1-methylpyrazol-5-yl)-3-[(2S)-1-hydroxy-3-phenylpropan-2-yl]urea |
| SMILES | CCc1cc(NC(=O)N[C@H](CO)Cc2ccccc2)n(C)n1 |
| InChI | InChI=1S/C16H22N4O2/c1-3-13-10-15(20(2)19-13)18-16(22)17-14(11-21)9-12-7-5-4-6-8-12/h4-8,10,14,21H,3,9,11H2,1-2H3,(H2,17,18,22)/t14-/m0/s1 |
| InChIKey | XZXANWXSSKFZJB-AWEZNQCLSA-N |
| XLogP | 1.71 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |