C12H13ClN4O2 — CID 167849671
4-chloro-1-ethyl-N-(4-methyl-3-oxopyrazin-2-yl)pyrrole-2-carboxamide (PubChem CID 167849671) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 4-chloro-1-ethyl-N-(4-methyl-3-oxopyrazin-2-yl)pyrrole-2-carboxamide.
| Compound Name | 4-chloro-1-ethyl-N-(4-methyl-3-oxopyrazin-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 167849671 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-chloro-1-ethyl-N-(4-methyl-3-oxopyrazin-2-yl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(Cl)cc1C(=O)Nc1nccn(C)c1=O |
| InChI | InChI=1S/C12H13ClN4O2/c1-3-17-7-8(13)6-9(17)11(18)15-10-12(19)16(2)5-4-14-10/h4-7H,3H2,1-2H3,(H,14,15,18) |
| InChIKey | MBLBDJFSWNGSEP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |