C7H13N3S — CID 83003423
1,1-dimethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]hydrazine (PubChem CID 83003423) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]hydrazine.
| Compound Name | 1,1-dimethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 83003423 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1,1-dimethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]hydrazine |
| SMILES | Cc1ncc(CNN(C)C)s1 |
| InChI | InChI=1S/C7H13N3S/c1-6-8-4-7(11-6)5-9-10(2)3/h4,9H,5H2,1-3H3 |
| InChIKey | PXZVOMDPLNTQTQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|