(2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid

C7H10N2O2S — CID 15458721

IUPAC(2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid
SMILESCc1ncc(C[C@@H](N)C(=O)O)s1
InChIInChI=1S/C7H10N2O2S/c1-4-9-3-5(12-4)2-6(8)7(10)11/h3,6H,2,8H2,1H3,(H,10,11)/t6-/m1/s1
InChIKeyMOYJHNSIMNVRQP-ZCFIWIBFSA-N
MW186.24 g/mol
LogP0.41
Rot. Bonds3

About (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid

(2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid (PubChem CID 15458721) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid
PubChem CID15458721
Molecular FormulaC7H10N2O2S
Molecular Weight186.24 g/mol
Exact Mass186.05
IUPAC Name(2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid
SMILESCc1ncc(C[C@@H](N)C(=O)O)s1
InChIInChI=1S/C7H10N2O2S/c1-4-9-3-5(12-4)2-6(8)7(10)11/h3,6H,2,8H2,1H3,(H,10,11)/t6-/m1/s1
InChIKeyMOYJHNSIMNVRQP-ZCFIWIBFSA-N
XLogP0.41
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.24
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid?
The IUPAC name of (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid (CID 15458721) is (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid is Cc1ncc(C[C@@H](N)C(=O)O)s1.
What is the InChIKey of (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid?
The InChIKey is MOYJHNSIMNVRQP-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-4-9-3-5(12-4)2-6(8)7(10)11/h3,6H,2,8H2,1H3,(H,10,11)/t6-/m1/s1.
What are the key properties of (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid?
(2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid has a molecular weight of 186.24 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid is sourced from PubChem (CID 15458721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).