C7H10N2O2S — CID 15458721
(2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid (PubChem CID 15458721) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 15458721 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (2R)-2-amino-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid |
| SMILES | Cc1ncc(C[C@@H](N)C(=O)O)s1 |
| InChI | InChI=1S/C7H10N2O2S/c1-4-9-3-5(12-4)2-6(8)7(10)11/h3,6H,2,8H2,1H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | MOYJHNSIMNVRQP-ZCFIWIBFSA-N |
| XLogP | 0.41 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |