C14H18BrClO3S — CID 66034411
3-[1-(2-bromo-5-methoxyphenyl)-3-chloropropan-2-yl]thiolane 1,1-dioxide (PubChem CID 66034411) has the molecular formula C14H18BrClO3S and a molecular weight of 381.72 g/mol. Its IUPAC name is 3-[1-(2-bromo-5-methoxyphenyl)-3-chloropropan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-(2-bromo-5-methoxyphenyl)-3-chloropropan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66034411 |
| Molecular Formula | C14H18BrClO3S |
| Molecular Weight | 381.72 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 3-[1-(2-bromo-5-methoxyphenyl)-3-chloropropan-2-yl]thiolane 1,1-dioxide |
| SMILES | COc1ccc(Br)c(CC(CCl)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H18BrClO3S/c1-19-13-2-3-14(15)11(7-13)6-12(8-16)10-4-5-20(17,18)9-10/h2-3,7,10,12H,4-6,8-9H2,1H3 |
| InChIKey | COQUPGRFCNHIHT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|