C13H17BrO3S — CID 64904387
3-[1-bromo-2-(4-methoxyphenyl)ethyl]thiolane 1,1-dioxide (PubChem CID 64904387) has the molecular formula C13H17BrO3S and a molecular weight of 333.25 g/mol. Its IUPAC name is 3-[1-bromo-2-(4-methoxyphenyl)ethyl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(4-methoxyphenyl)ethyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64904387 |
| Molecular Formula | C13H17BrO3S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 3-[1-bromo-2-(4-methoxyphenyl)ethyl]thiolane 1,1-dioxide |
| SMILES | COc1ccc(CC(Br)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H17BrO3S/c1-17-12-4-2-10(3-5-12)8-13(14)11-6-7-18(15,16)9-11/h2-5,11,13H,6-9H2,1H3 |
| InChIKey | HYXNERAMVKLMBR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|