C13H18O4S — CID 113323142
1-[4-(1,1-dioxothiolan-3-yl)oxyphenyl]propan-2-ol (PubChem CID 113323142) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-[4-(1,1-dioxothiolan-3-yl)oxyphenyl]propan-2-ol.
| Compound Name | 1-[4-(1,1-dioxothiolan-3-yl)oxyphenyl]propan-2-ol |
|---|---|
| PubChem CID | 113323142 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-[4-(1,1-dioxothiolan-3-yl)oxyphenyl]propan-2-ol |
| SMILES | CC(O)Cc1ccc(OC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-10(14)8-11-2-4-12(5-3-11)17-13-6-7-18(15,16)9-13/h2-5,10,13-14H,6-9H2,1H3 |
| InChIKey | CEERUPKKFUSJDN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |