C13H18O5S — CID 115495876
4-[4-(2-hydroxypropyl)phenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 115495876) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-[4-(2-hydroxypropyl)phenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[4-(2-hydroxypropyl)phenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 115495876 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-[4-(2-hydroxypropyl)phenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | CC(O)Cc1ccc(OC2CS(=O)(=O)CC2O)cc1 |
| InChI | InChI=1S/C13H18O5S/c1-9(14)6-10-2-4-11(5-3-10)18-13-8-19(16,17)7-12(13)15/h2-5,9,12-15H,6-8H2,1H3 |
| InChIKey | IARVKGUZBPQNFK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |