C12H17NO4S — CID 60882599
4-[3-(methylaminomethyl)phenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 60882599) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-[3-(methylaminomethyl)phenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[3-(methylaminomethyl)phenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60882599 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-[3-(methylaminomethyl)phenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | CNCc1cccc(OC2CS(=O)(=O)CC2O)c1 |
| InChI | InChI=1S/C12H17NO4S/c1-13-6-9-3-2-4-10(5-9)17-12-8-18(15,16)7-11(12)14/h2-5,11-14H,6-8H2,1H3 |
| InChIKey | QIEINQMVXWICBD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |