C12H16O4S — CID 60877831
4-(3-ethylphenoxy)-1,1-dioxothiolan-3-ol (PubChem CID 60877831) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 4-(3-ethylphenoxy)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(3-ethylphenoxy)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60877831 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-(3-ethylphenoxy)-1,1-dioxothiolan-3-ol |
| SMILES | CCc1cccc(OC2CS(=O)(=O)CC2O)c1 |
| InChI | InChI=1S/C12H16O4S/c1-2-9-4-3-5-10(6-9)16-12-8-17(14,15)7-11(12)13/h3-6,11-13H,2,7-8H2,1H3 |
| InChIKey | UEBBRNBHYVSLQE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |