C15H23NO4S — CID 60889931
4-[4-[1-(ethylamino)propyl]phenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 60889931) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-[4-[1-(ethylamino)propyl]phenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[4-[1-(ethylamino)propyl]phenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60889931 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-[4-[1-(ethylamino)propyl]phenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | CCNC(CC)c1ccc(OC2CS(=O)(=O)CC2O)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-3-13(16-4-2)11-5-7-12(8-6-11)20-15-10-21(18,19)9-14(15)17/h5-8,13-17H,3-4,9-10H2,1-2H3 |
| InChIKey | PAELARVRNCHOGQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |