C13H16O4 — CID 115496011
3-[4-(2-hydroxypropyl)phenoxy]oxolan-2-one (PubChem CID 115496011) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-[4-(2-hydroxypropyl)phenoxy]oxolan-2-one.
| Compound Name | 3-[4-(2-hydroxypropyl)phenoxy]oxolan-2-one |
|---|---|
| PubChem CID | 115496011 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-[4-(2-hydroxypropyl)phenoxy]oxolan-2-one |
| SMILES | CC(O)Cc1ccc(OC2CCOC2=O)cc1 |
| InChI | InChI=1S/C13H16O4/c1-9(14)8-10-2-4-11(5-3-10)17-12-6-7-16-13(12)15/h2-5,9,12,14H,6-8H2,1H3 |
| InChIKey | UOXFLPDAXPWCMN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |