C14H20N2O4S — CID 115410748
1,1-dioxo-4-(4-piperazin-1-ylphenoxy)thiolan-3-ol (PubChem CID 115410748) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1,1-dioxo-4-(4-piperazin-1-ylphenoxy)thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-(4-piperazin-1-ylphenoxy)thiolan-3-ol |
|---|---|
| PubChem CID | 115410748 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1,1-dioxo-4-(4-piperazin-1-ylphenoxy)thiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(Oc2ccc(N3CCNCC3)cc2)C1 |
| InChI | InChI=1S/C14H20N2O4S/c17-13-9-21(18,19)10-14(13)20-12-3-1-11(2-4-12)16-7-5-15-6-8-16/h1-4,13-15,17H,5-10H2 |
| InChIKey | ASLWVCJDEMDYPH-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|