C15H22N2O4S — CID 4798798
4-[4-(4-methoxyphenyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 4798798) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 4798798 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | COc1ccc(N2CCN(C3CS(=O)(=O)CC3O)CC2)cc1 |
| InChI | InChI=1S/C15H22N2O4S/c1-21-13-4-2-12(3-5-13)16-6-8-17(9-7-16)14-10-22(19,20)11-15(14)18/h2-5,14-15,18H,6-11H2,1H3 |
| InChIKey | COPNSOACXAOPIP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|