C15H22N2O3S — CID 60703870
4-[4-(3-methylphenyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 60703870) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-[4-(3-methylphenyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60703870 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | Cc1cccc(N2CCN(C3CS(=O)(=O)CC3O)CC2)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-12-3-2-4-13(9-12)16-5-7-17(8-6-16)14-10-21(19,20)11-15(14)18/h2-4,9,14-15,18H,5-8,10-11H2,1H3 |
| InChIKey | JXSSBYGSLHGAOA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |