C13H20N2 — CID 118420862
1-methyl-4-(3-methylphenyl)-1,4-diazepane (PubChem CID 118420862) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-methyl-4-(3-methylphenyl)-1,4-diazepane.
| Compound Name | 1-methyl-4-(3-methylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 118420862 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-methyl-4-(3-methylphenyl)-1,4-diazepane |
| SMILES | Cc1cccc(N2CCCN(C)CC2)c1 |
| InChI | InChI=1S/C13H20N2/c1-12-5-3-6-13(11-12)15-8-4-7-14(2)9-10-15/h3,5-6,11H,4,7-10H2,1-2H3 |
| InChIKey | XPAIWSUJINANNO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |