C15H23N3O2S — CID 110705779
1-(3-methylphenyl)-4-pyrrolidin-1-ylsulfonylpiperazine (PubChem CID 110705779) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-(3-methylphenyl)-4-pyrrolidin-1-ylsulfonylpiperazine.
| Compound Name | 1-(3-methylphenyl)-4-pyrrolidin-1-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 110705779 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(3-methylphenyl)-4-pyrrolidin-1-ylsulfonylpiperazine |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)N3CCCC3)CC2)c1 |
| InChI | InChI=1S/C15H23N3O2S/c1-14-5-4-6-15(13-14)16-9-11-18(12-10-16)21(19,20)17-7-2-3-8-17/h4-6,13H,2-3,7-12H2,1H3 |
| InChIKey | GSXLZDZHZDSHJY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |