C20H26N2O3S — CID 112823078
1-(4-methoxy-3,5-dimethylphenyl)sulfonyl-4-(3-methylphenyl)piperazine (PubChem CID 112823078) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-(4-methoxy-3,5-dimethylphenyl)sulfonyl-4-(3-methylphenyl)piperazine.
| Compound Name | 1-(4-methoxy-3,5-dimethylphenyl)sulfonyl-4-(3-methylphenyl)piperazine |
|---|---|
| PubChem CID | 112823078 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-(4-methoxy-3,5-dimethylphenyl)sulfonyl-4-(3-methylphenyl)piperazine |
| SMILES | COc1c(C)cc(S(=O)(=O)N2CCN(c3cccc(C)c3)CC2)cc1C |
| InChI | InChI=1S/C20H26N2O3S/c1-15-6-5-7-18(12-15)21-8-10-22(11-9-21)26(23,24)19-13-16(2)20(25-4)17(3)14-19/h5-7,12-14H,8-11H2,1-4H3 |
| InChIKey | HYQLGMCZEXQZKB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |