C20H28N6 — CID 112888119
4-[4-(3-methylphenyl)piperazin-1-yl]-2-(4-methylpiperazin-1-yl)pyrimidine (PubChem CID 112888119) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is 4-[4-(3-methylphenyl)piperazin-1-yl]-2-(4-methylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-2-(4-methylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 112888119 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-2-(4-methylpiperazin-1-yl)pyrimidine |
| SMILES | Cc1cccc(N2CCN(c3ccnc(N4CCN(C)CC4)n3)CC2)c1 |
| InChI | InChI=1S/C20H28N6/c1-17-4-3-5-18(16-17)24-12-14-25(15-13-24)19-6-7-21-20(22-19)26-10-8-23(2)9-11-26/h3-7,16H,8-15H2,1-2H3 |
| InChIKey | FLDINRKZUVBTCQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |