C6H11NO3S — CID 6357828
(3S,4S)-4-(aziridin-1-yl)-1,1-dioxothiolan-3-ol (PubChem CID 6357828) has the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. Its IUPAC name is (3S,4S)-4-(aziridin-1-yl)-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-(aziridin-1-yl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 6357828 |
| Molecular Formula | C6H11NO3S |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | (3S,4S)-4-(aziridin-1-yl)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](N2CC2)C1 |
| InChI | InChI=1S/C6H11NO3S/c8-6-4-11(9,10)3-5(6)7-1-2-7/h5-6,8H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | KHGUSBIFYZRKAF-PHDIDXHHSA-N |
| XLogP | -1.54 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|