C9H18N2O3S — CID 126846760
(3S,4S)-4-(1,4-diazepan-1-yl)-1,1-dioxothiolan-3-ol (PubChem CID 126846760) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is (3S,4S)-4-(1,4-diazepan-1-yl)-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-(1,4-diazepan-1-yl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 126846760 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (3S,4S)-4-(1,4-diazepan-1-yl)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](N2CCCNCC2)C1 |
| InChI | InChI=1S/C9H18N2O3S/c12-9-7-15(13,14)6-8(9)11-4-1-2-10-3-5-11/h8-10,12H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | TXLCEMQNHJPJCX-RKDXNWHRSA-N |
| XLogP | -1.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |