C10H18N2O4S — CID 60666013
1-(4-hydroxy-1,1-dioxothiolan-3-yl)piperidine-4-carboxamide (PubChem CID 60666013) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-(4-hydroxy-1,1-dioxothiolan-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-(4-hydroxy-1,1-dioxothiolan-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60666013 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-(4-hydroxy-1,1-dioxothiolan-3-yl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CS(=O)(=O)CC2O)CC1 |
| InChI | InChI=1S/C10H18N2O4S/c11-10(14)7-1-3-12(4-2-7)8-5-17(15,16)6-9(8)13/h7-9,13H,1-6H2,(H2,11,14) |
| InChIKey | GBTLEHNKSVTTDU-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |