C10H19N3O3S — CID 55108616
1-(4-amino-1,1-dioxothiolan-3-yl)piperidine-3-carboxamide (PubChem CID 55108616) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 1-(4-amino-1,1-dioxothiolan-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-(4-amino-1,1-dioxothiolan-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55108616 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-(4-amino-1,1-dioxothiolan-3-yl)piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(C2CS(=O)(=O)CC2N)C1 |
| InChI | InChI=1S/C10H19N3O3S/c11-8-5-17(15,16)6-9(8)13-3-1-2-7(4-13)10(12)14/h7-9H,1-6,11H2,(H2,12,14) |
| InChIKey | IOHGHVPCKGJHNO-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |