C11H22N2O2S — CID 63624640
4-(4-methylazepan-1-yl)-1,1-dioxothiolan-3-amine (PubChem CID 63624640) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 4-(4-methylazepan-1-yl)-1,1-dioxothiolan-3-amine.
| Compound Name | 4-(4-methylazepan-1-yl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 63624640 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-(4-methylazepan-1-yl)-1,1-dioxothiolan-3-amine |
| SMILES | CC1CCCN(C2CS(=O)(=O)CC2N)CC1 |
| InChI | InChI=1S/C11H22N2O2S/c1-9-3-2-5-13(6-4-9)11-8-16(14,15)7-10(11)12/h9-11H,2-8,12H2,1H3 |
| InChIKey | QEJNJOVFZYZUBG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |