C9H18N2O3S — CID 62691462
4-(2-methylmorpholin-4-yl)-1,1-dioxothiolan-3-amine (PubChem CID 62691462) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-(2-methylmorpholin-4-yl)-1,1-dioxothiolan-3-amine.
| Compound Name | 4-(2-methylmorpholin-4-yl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 62691462 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-(2-methylmorpholin-4-yl)-1,1-dioxothiolan-3-amine |
| SMILES | CC1CN(C2CS(=O)(=O)CC2N)CCO1 |
| InChI | InChI=1S/C9H18N2O3S/c1-7-4-11(2-3-14-7)9-6-15(12,13)5-8(9)10/h7-9H,2-6,10H2,1H3 |
| InChIKey | VWSRIEZMHKEJTQ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |