About (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide
(3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide (PubChem CID 30979824) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide |
| PubChem CID | 30979824 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](N2CCC[C@@H](C(N)=O)C2)C1 |
| InChI | InChI=1S/C12H22N2O/c1-9-4-5-11(7-9)14-6-2-3-10(8-14)12(13)15/h9-11H,2-8H2,1H3,(H2,13,15)/t9-,10-,11-/m1/s1 |
| InChIKey | ZZEINKPTFWVMPI-GMTAPVOTSA-N |
| XLogP | 1.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide?
The IUPAC name of (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide (CID 30979824) is (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide.
What is the SMILES notation for (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide?
The canonical SMILES for (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide is C[C@@H]1CC[C@@H](N2CCC[C@@H](C(N)=O)C2)C1.
What is the InChIKey of (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide?
The InChIKey is ZZEINKPTFWVMPI-GMTAPVOTSA-N. The full InChI is InChI=1S/C12H22N2O/c1-9-4-5-11(7-9)14-6-2-3-10(8-14)12(13)15/h9-11H,2-8H2,1H3,(H2,13,15)/t9-,10-,11-/m1/s1.
What are the key properties of (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide?
(3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide has a molecular weight of 210.32 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[(1R,3R)-3-methylcyclopentyl]piperidine-3-carboxamide is sourced from PubChem (CID 30979824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).