C7H13NO — CID 142105884
cis-(1S,3R)-3-methylcyclopentane-1-carboxamide (PubChem CID 142105884) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is cis-(1S,3R)-3-methylcyclopentane-1-carboxamide.
| Compound Name | cis-(1S,3R)-3-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 142105884 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | cis-(1S,3R)-3-methylcyclopentane-1-carboxamide |
| SMILES | C[C@@H]1CC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C7H13NO/c1-5-2-3-6(4-5)7(8)9/h5-6H,2-4H2,1H3,(H2,8,9)/t5-,6+/m1/s1 |
| InChIKey | ZYFCJOQNKMJDJQ-RITPCOANSA-N |
| XLogP | 0.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |